C20H33NO2 — CID 70858624
N-(4-hydroxyphenyl)-2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanamide (PubChem CID 70858624) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanamide.
| Compound Name | N-(4-hydroxyphenyl)-2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanamide |
|---|---|
| PubChem CID | 70858624 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | N-(4-hydroxyphenyl)-2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanamide |
| SMILES | CCC(C)(C)CC(C)(C(=O)Nc1ccc(O)cc1)C(C)(C)CC |
| InChI | InChI=1S/C20H33NO2/c1-8-18(3,4)14-20(7,19(5,6)9-2)17(23)21-15-10-12-16(22)13-11-15/h10-13,22H,8-9,14H2,1-7H3,(H,21,23) |
| InChIKey | MWBCLEMGWOUVQO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|