C11H14N2O5 — CID 69120648
[(2S)-3-hydroxy-1-(4-hydroxyanilino)-2-methyl-1-oxopropan-2-yl]carbamic acid (PubChem CID 69120648) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is [(2S)-3-hydroxy-1-(4-hydroxyanilino)-2-methyl-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [(2S)-3-hydroxy-1-(4-hydroxyanilino)-2-methyl-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69120648 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | [(2S)-3-hydroxy-1-(4-hydroxyanilino)-2-methyl-1-oxopropan-2-yl]carbamic acid |
| SMILES | C[C@@](CO)(NC(=O)O)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C11H14N2O5/c1-11(6-14,13-10(17)18)9(16)12-7-2-4-8(15)5-3-7/h2-5,13-15H,6H2,1H3,(H,12,16)(H,17,18)/t11-/m0/s1 |
| InChIKey | OUMCVAPVJLFBFD-NSHDSACASA-N |
| XLogP | 0.35 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|