C17H26N2O3 — CID 134533395
N-[4-[2-(hydroxyamino)-2-oxoethyl]phenyl]-2,2,4,4-tetramethylpentanamide (PubChem CID 134533395) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[4-[2-(hydroxyamino)-2-oxoethyl]phenyl]-2,2,4,4-tetramethylpentanamide.
| Compound Name | N-[4-[2-(hydroxyamino)-2-oxoethyl]phenyl]-2,2,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 134533395 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-[4-[2-(hydroxyamino)-2-oxoethyl]phenyl]-2,2,4,4-tetramethylpentanamide |
| SMILES | CC(C)(C)CC(C)(C)C(=O)Nc1ccc(CC(=O)NO)cc1 |
| InChI | InChI=1S/C17H26N2O3/c1-16(2,3)11-17(4,5)15(21)18-13-8-6-12(7-9-13)10-14(20)19-22/h6-9,22H,10-11H2,1-5H3,(H,18,21)(H,19,20) |
| InChIKey | WRBQNBVEAJGCJG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|