C23H45N2O+ — CID 143837735
ethane;ethyl-dimethyl-[4-(2,2,4,4-tetramethylpentanoylamino)phenyl]azanium (PubChem CID 143837735) has the molecular formula C23H45N2O+ and a molecular weight of 365.63 g/mol. Its IUPAC name is ethane;ethyl-dimethyl-[4-(2,2,4,4-tetramethylpentanoylamino)phenyl]azanium.
| Compound Name | ethane;ethyl-dimethyl-[4-(2,2,4,4-tetramethylpentanoylamino)phenyl]azanium |
|---|---|
| PubChem CID | 143837735 |
| Molecular Formula | C23H45N2O+ |
| Molecular Weight | 365.63 g/mol |
| Exact Mass | 365.35 |
| IUPAC Name | ethane;ethyl-dimethyl-[4-(2,2,4,4-tetramethylpentanoylamino)phenyl]azanium |
| SMILES | CC.CC.CC[N+](C)(C)c1ccc(NC(=O)C(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H32N2O.2C2H6/c1-9-21(7,8)16-12-10-15(11-13-16)20-17(22)19(5,6)14-18(2,3)4;2*1-2/h10-13H,9,14H2,1-8H3;2*1-2H3/p+1 |
| InChIKey | LKBHPTPNFAGEEW-UHFFFAOYSA-O |
| XLogP | 6.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.63 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|