C17H25NO2 — CID 143619432
N-(4-acetylphenyl)-2,2,4,4-tetramethylpentanamide (PubChem CID 143619432) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2,2,4,4-tetramethylpentanamide.
| Compound Name | N-(4-acetylphenyl)-2,2,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 143619432 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-(4-acetylphenyl)-2,2,4,4-tetramethylpentanamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25NO2/c1-12(19)13-7-9-14(10-8-13)18-15(20)17(5,6)11-16(2,3)4/h7-10H,11H2,1-6H3,(H,18,20) |
| InChIKey | AHLBHCAWIBVYSL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |