C26H31N9O6 — CID 122648339
N-hydroxy-2-[methyl-[[9-methyl-6-morpholin-4-yl-2-(3,4,5-trimethoxyphenyl)purin-8-yl]methyl]amino]pyrimidine-5-carboxamide (PubChem CID 122648339) has the molecular formula C26H31N9O6 and a molecular weight of 565.59 g/mol. Its IUPAC name is N-hydroxy-2-[methyl-[[9-methyl-6-morpholin-4-yl-2-(3,4,5-trimethoxyphenyl)purin-8-yl]methyl]amino]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[methyl-[[9-methyl-6-morpholin-4-yl-2-(3,4,5-trimethoxyphenyl)purin-8-yl]methyl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122648339 |
| Molecular Formula | C26H31N9O6 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | N-hydroxy-2-[methyl-[[9-methyl-6-morpholin-4-yl-2-(3,4,5-trimethoxyphenyl)purin-8-yl]methyl]amino]pyrimidine-5-carboxamide |
| SMILES | COc1cc(-c2nc(N3CCOCC3)c3nc(CN(C)c4ncc(C(=O)NO)cn4)n(C)c3n2)cc(OC)c1OC |
| InChI | InChI=1S/C26H31N9O6/c1-33(26-27-12-16(13-28-26)25(36)32-37)14-19-29-20-23(34(19)2)30-22(31-24(20)35-6-8-41-9-7-35)15-10-17(38-3)21(40-5)18(11-15)39-4/h10-13,37H,6-9,14H2,1-5H3,(H,32,36) |
| InChIKey | HHDYRXKUDYTQHA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 162.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|