C24H25N9O5 — CID 122648366
2-[[2-(1,3-benzodioxol-5-yl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 122648366) has the molecular formula C24H25N9O5 and a molecular weight of 519.52 g/mol. Its IUPAC name is 2-[[2-(1,3-benzodioxol-5-yl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[[2-(1,3-benzodioxol-5-yl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122648366 |
| Molecular Formula | C24H25N9O5 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 2-[[2-(1,3-benzodioxol-5-yl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | CN(Cc1nc2c(N3CCOCC3)nc(-c3ccc4c(c3)OCO4)nc2n1C)c1ncc(C(=O)NO)cn1 |
| InChI | InChI=1S/C24H25N9O5/c1-31(24-25-10-15(11-26-24)23(34)30-35)12-18-27-19-21(32(18)2)28-20(29-22(19)33-5-7-36-8-6-33)14-3-4-16-17(9-14)38-13-37-16/h3-4,9-11,35H,5-8,12-13H2,1-2H3,(H,30,34) |
| InChIKey | JSWBEZKWVWBEIP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 152.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|