C23H25N9O4 — CID 122648346
N-hydroxy-2-[[2-(3-hydroxyphenyl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]pyrimidine-5-carboxamide (PubChem CID 122648346) has the molecular formula C23H25N9O4 and a molecular weight of 491.51 g/mol. Its IUPAC name is N-hydroxy-2-[[2-(3-hydroxyphenyl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[[2-(3-hydroxyphenyl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122648346 |
| Molecular Formula | C23H25N9O4 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N-hydroxy-2-[[2-(3-hydroxyphenyl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]pyrimidine-5-carboxamide |
| SMILES | CN(Cc1nc2c(N3CCOCC3)nc(-c3cccc(O)c3)nc2n1C)c1ncc(C(=O)NO)cn1 |
| InChI | InChI=1S/C23H25N9O4/c1-30(23-24-11-15(12-25-23)22(34)29-35)13-17-26-18-20(31(17)2)27-19(14-4-3-5-16(33)10-14)28-21(18)32-6-8-36-9-7-32/h3-5,10-12,33,35H,6-9,13H2,1-2H3,(H,29,34) |
| InChIKey | OYZRBANGKNWYNU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 154.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|