C24H24F3N9O3 — CID 122648553
N-hydroxy-2-[methyl-[[9-methyl-6-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]purin-8-yl]methyl]amino]pyrimidine-5-carboxamide (PubChem CID 122648553) has the molecular formula C24H24F3N9O3 and a molecular weight of 543.51 g/mol. Its IUPAC name is N-hydroxy-2-[methyl-[[9-methyl-6-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]purin-8-yl]methyl]amino]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[methyl-[[9-methyl-6-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]purin-8-yl]methyl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122648553 |
| Molecular Formula | C24H24F3N9O3 |
| Molecular Weight | 543.51 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | N-hydroxy-2-[methyl-[[9-methyl-6-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]purin-8-yl]methyl]amino]pyrimidine-5-carboxamide |
| SMILES | CN(Cc1nc2c(N3CCOCC3)nc(-c3ccc(C(F)(F)F)cc3)nc2n1C)c1ncc(C(=O)NO)cn1 |
| InChI | InChI=1S/C24H24F3N9O3/c1-34(23-28-11-15(12-29-23)22(37)33-38)13-17-30-18-20(35(17)2)31-19(32-21(18)36-7-9-39-10-8-36)14-3-5-16(6-4-14)24(25,26)27/h3-6,11-12,38H,7-10,13H2,1-2H3,(H,33,37) |
| InChIKey | BRNKRTPTUZOCPU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|