C25H23F6N9O3 — CID 122648568
2-[[2-[3,5-bis(trifluoromethyl)phenyl]-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 122648568) has the molecular formula C25H23F6N9O3 and a molecular weight of 611.51 g/mol. Its IUPAC name is 2-[[2-[3,5-bis(trifluoromethyl)phenyl]-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[[2-[3,5-bis(trifluoromethyl)phenyl]-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122648568 |
| Molecular Formula | C25H23F6N9O3 |
| Molecular Weight | 611.51 g/mol |
| Exact Mass | 611.18 |
| IUPAC Name | 2-[[2-[3,5-bis(trifluoromethyl)phenyl]-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | CN(Cc1nc2c(N3CCOCC3)nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)nc2n1C)c1ncc(C(=O)NO)cn1 |
| InChI | InChI=1S/C25H23F6N9O3/c1-38(23-32-10-14(11-33-23)22(41)37-42)12-17-34-18-20(39(17)2)35-19(36-21(18)40-3-5-43-6-4-40)13-7-15(24(26,27)28)9-16(8-13)25(29,30)31/h7-11,42H,3-6,12H2,1-2H3,(H,37,41) |
| InChIKey | QHYVUXHAPSTTDP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|