C25H29N9O3 — CID 122648571
2-[[2-(4-ethylphenyl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 122648571) has the molecular formula C25H29N9O3 and a molecular weight of 503.57 g/mol. Its IUPAC name is 2-[[2-(4-ethylphenyl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[[2-(4-ethylphenyl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122648571 |
| Molecular Formula | C25H29N9O3 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 2-[[2-(4-ethylphenyl)-9-methyl-6-morpholin-4-ylpurin-8-yl]methyl-methylamino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | CCc1ccc(-c2nc(N3CCOCC3)c3nc(CN(C)c4ncc(C(=O)NO)cn4)n(C)c3n2)cc1 |
| InChI | InChI=1S/C25H29N9O3/c1-4-16-5-7-17(8-6-16)21-29-22-20(23(30-21)34-9-11-37-12-10-34)28-19(33(22)3)15-32(2)25-26-13-18(14-27-25)24(35)31-36/h5-8,13-14,36H,4,9-12,15H2,1-3H3,(H,31,35) |
| InChIKey | ILMBVTBLVLZLAE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|