C9H21N3O2 — CID 122650192
6-(ethoxyamino)-2-(methylamino)hexanamide (PubChem CID 122650192) has the molecular formula C9H21N3O2 and a molecular weight of 203.29 g/mol. Its IUPAC name is 6-(ethoxyamino)-2-(methylamino)hexanamide.
| Compound Name | 6-(ethoxyamino)-2-(methylamino)hexanamide |
|---|---|
| PubChem CID | 122650192 |
| Molecular Formula | C9H21N3O2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.16 |
| IUPAC Name | 6-(ethoxyamino)-2-(methylamino)hexanamide |
| SMILES | CCONCCCCC(NC)C(N)=O |
| InChI | InChI=1S/C9H21N3O2/c1-3-14-12-7-5-4-6-8(11-2)9(10)13/h8,11-12H,3-7H2,1-2H3,(H2,10,13) |
| InChIKey | FAKFEKJLCRWBDP-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|