C22H32N2O — CID 122650312
4,6-dimethyl-N-[(2S,3S,5R)-2,3,4,4,5-pentamethylcyclohexyl]-1H-indole-2-carboxamide (PubChem CID 122650312) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is 4,6-dimethyl-N-[(2S,3S,5R)-2,3,4,4,5-pentamethylcyclohexyl]-1H-indole-2-carboxamide.
| Compound Name | 4,6-dimethyl-N-[(2S,3S,5R)-2,3,4,4,5-pentamethylcyclohexyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 122650312 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 4,6-dimethyl-N-[(2S,3S,5R)-2,3,4,4,5-pentamethylcyclohexyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)c2cc(C(=O)NC3C[C@@H](C)C(C)(C)[C@@H](C)[C@@H]3C)[nH]c2c1 |
| InChI | InChI=1S/C22H32N2O/c1-12-8-13(2)17-11-20(23-19(17)9-12)21(25)24-18-10-14(3)22(6,7)16(5)15(18)4/h8-9,11,14-16,18,23H,10H2,1-7H3,(H,24,25)/t14-,15+,16+,18?/m1/s1 |
| InChIKey | HYKWOSGPKWTFJZ-PGQZYJQNSA-N |
| XLogP | 5.22 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |