C18H22ClN3O — CID 175283473
4-chloro-N-[(2S,3S,4S)-3,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 175283473) has the molecular formula C18H22ClN3O and a molecular weight of 331.85 g/mol. Its IUPAC name is 4-chloro-N-[(2S,3S,4S)-3,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-[(2S,3S,4S)-3,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175283473 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 4-chloro-N-[(2S,3S,4S)-3,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | C[C@@H]1[C@@H](NC(=O)c2cc3c(Cl)cncc3[nH]2)C2C[C@@H]1C(C)(C)C2 |
| InChI | InChI=1S/C18H22ClN3O/c1-9-12-4-10(6-18(12,2)3)16(9)22-17(23)14-5-11-13(19)7-20-8-15(11)21-14/h5,7-10,12,16,21H,4,6H2,1-3H3,(H,22,23)/t9-,10?,12-,16+/m0/s1 |
| InChIKey | LUMHQEJXJHHEJW-FEPIWBNNSA-N |
| XLogP | 4.02 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |