C18H24ClN3OSi — CID 156715455
4-chloro-N-(6-silaspiro[5.5]undecan-3-yl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 156715455) has the molecular formula C18H24ClN3OSi and a molecular weight of 361.95 g/mol. Its IUPAC name is 4-chloro-N-(6-silaspiro[5.5]undecan-3-yl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-(6-silaspiro[5.5]undecan-3-yl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 156715455 |
| Molecular Formula | C18H24ClN3OSi |
| Molecular Weight | 361.95 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 4-chloro-N-(6-silaspiro[5.5]undecan-3-yl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NC1CC[Si]2(CCCCC2)CC1)c1cc2c(Cl)cncc2[nH]1 |
| InChI | InChI=1S/C18H24ClN3OSi/c19-15-11-20-12-17-14(15)10-16(22-17)18(23)21-13-4-8-24(9-5-13)6-2-1-3-7-24/h10-13,22H,1-9H2,(H,21,23) |
| InChIKey | GIGNFFATORTYBA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.95 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|