C16H22ClN3OSi — CID 156715187
4-chloro-N-(1,1-dimethylsilinan-4-yl)-6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide (PubChem CID 156715187) has the molecular formula C16H22ClN3OSi and a molecular weight of 335.91 g/mol. Its IUPAC name is 4-chloro-N-(1,1-dimethylsilinan-4-yl)-6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-(1,1-dimethylsilinan-4-yl)-6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 156715187 |
| Molecular Formula | C16H22ClN3OSi |
| Molecular Weight | 335.91 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4-chloro-N-(1,1-dimethylsilinan-4-yl)-6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1cc(Cl)c2cc(C(=O)NC3CC[Si](C)(C)CC3)[nH]c2n1 |
| InChI | InChI=1S/C16H22ClN3OSi/c1-10-8-13(17)12-9-14(20-15(12)18-10)16(21)19-11-4-6-22(2,3)7-5-11/h8-9,11H,4-7H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | DSQAZKFWOZYGCB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.91 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|