C28H44N6O3S2Si2 — CID 167649955
1,1-dimethylsilinan-4-amine;N-(1,1-dimethylsilinan-4-yl)-2-methyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide;2-methyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylic acid (PubChem CID 167649955) has the molecular formula C28H44N6O3S2Si2 and a molecular weight of 633.01 g/mol. Its IUPAC name is 1,1-dimethylsilinan-4-amine;N-(1,1-dimethylsilinan-4-yl)-2-methyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide;2-methyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylic acid.
| Compound Name | 1,1-dimethylsilinan-4-amine;N-(1,1-dimethylsilinan-4-yl)-2-methyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide;2-methyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 167649955 |
| Molecular Formula | C28H44N6O3S2Si2 |
| Molecular Weight | 633.01 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | 1,1-dimethylsilinan-4-amine;N-(1,1-dimethylsilinan-4-yl)-2-methyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide;2-methyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylic acid |
| SMILES | C[Si]1(C)CCC(N)CC1.Cc1nc2[nH]c(C(=O)NC3CC[Si](C)(C)CC3)cc2s1.Cc1nc2[nH]c(C(=O)O)cc2s1 |
| InChI | InChI=1S/C14H21N3OSSi.C7H6N2O2S.C7H17NSi/c1-9-15-13-12(19-9)8-11(17-13)14(18)16-10-4-6-20(2,3)7-5-10;1-3-8-6-5(12-3)2-4(9-6)7(10)11;1-9(2)5-3-7(8)4-6-9/h8,10,17H,4-7H2,1-3H3,(H,16,18);2,9H,1H3,(H,10,11);7H,3-6,8H2,1-2H3 |
| InChIKey | QKUCEJVCFXQZEO-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 149.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.01 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|