C20H24N4OSi — CID 156715500
N-(1,1-dimethylsilinan-4-yl)-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide (PubChem CID 156715500) has the molecular formula C20H24N4OSi and a molecular weight of 364.53 g/mol. Its IUPAC name is N-(1,1-dimethylsilinan-4-yl)-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-(1,1-dimethylsilinan-4-yl)-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 156715500 |
| Molecular Formula | C20H24N4OSi |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | N-(1,1-dimethylsilinan-4-yl)-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
| SMILES | C[Si]1(C)CCC(NC(=O)c2cc3cc(-c4cccnc4)cnc3[nH]2)CC1 |
| InChI | InChI=1S/C20H24N4OSi/c1-26(2)8-5-17(6-9-26)23-20(25)18-11-15-10-16(13-22-19(15)24-18)14-4-3-7-21-12-14/h3-4,7,10-13,17H,5-6,8-9H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | XWHVNMJHYIDYRG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|