C20H25N3O2SSi — CID 156715565
N-(1,1-dimethylsilinan-4-yl)-2-(2-methoxyphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 156715565) has the molecular formula C20H25N3O2SSi and a molecular weight of 399.59 g/mol. Its IUPAC name is N-(1,1-dimethylsilinan-4-yl)-2-(2-methoxyphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | N-(1,1-dimethylsilinan-4-yl)-2-(2-methoxyphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 156715565 |
| Molecular Formula | C20H25N3O2SSi |
| Molecular Weight | 399.59 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-(1,1-dimethylsilinan-4-yl)-2-(2-methoxyphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | COc1ccccc1-c1nc2[nH]c(C(=O)NC3CC[Si](C)(C)CC3)cc2s1 |
| InChI | InChI=1S/C20H25N3O2SSi/c1-25-16-7-5-4-6-14(16)20-23-18-17(26-20)12-15(22-18)19(24)21-13-8-10-27(2,3)11-9-13/h4-7,12-13,22H,8-11H2,1-3H3,(H,21,24) |
| InChIKey | NKHZNTYWKGDSFJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|