C36H44N6O3S2Si2 — CID 167671402
1,1-dimethylsilolan-3-amine;N-(1,1-dimethylsilolan-3-yl)-2-phenyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide;2-phenyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylic acid (PubChem CID 167671402) has the molecular formula C36H44N6O3S2Si2 and a molecular weight of 729.09 g/mol. Its IUPAC name is 1,1-dimethylsilolan-3-amine;N-(1,1-dimethylsilolan-3-yl)-2-phenyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide;2-phenyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylic acid.
| Compound Name | 1,1-dimethylsilolan-3-amine;N-(1,1-dimethylsilolan-3-yl)-2-phenyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide;2-phenyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 167671402 |
| Molecular Formula | C36H44N6O3S2Si2 |
| Molecular Weight | 729.09 g/mol |
| Exact Mass | 728.25 |
| IUPAC Name | 1,1-dimethylsilolan-3-amine;N-(1,1-dimethylsilolan-3-yl)-2-phenyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide;2-phenyl-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylic acid |
| SMILES | C[Si]1(C)CCC(N)C1.C[Si]1(C)CCC(NC(=O)c2cc3sc(-c4ccccc4)nc3[nH]2)C1.O=C(O)c1cc2sc(-c3ccccc3)nc2[nH]1 |
| InChI | InChI=1S/C18H21N3OSSi.C12H8N2O2S.C6H15NSi/c1-24(2)9-8-13(11-24)19-17(22)14-10-15-16(20-14)21-18(23-15)12-6-4-3-5-7-12;15-12(16)8-6-9-10(13-8)14-11(17-9)7-4-2-1-3-5-7;1-8(2)4-3-6(7)5-8/h3-7,10,13,20H,8-9,11H2,1-2H3,(H,19,22);1-6,13H,(H,15,16);6H,3-5,7H2,1-2H3 |
| InChIKey | UDYPTKWZRPTTJT-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 149.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.09 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|