C16H20F3N3OSi — CID 156715362
N-(1,1-dimethylsilinan-4-yl)-4-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxamide (PubChem CID 156715362) has the molecular formula C16H20F3N3OSi and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(1,1-dimethylsilinan-4-yl)-4-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-(1,1-dimethylsilinan-4-yl)-4-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 156715362 |
| Molecular Formula | C16H20F3N3OSi |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-(1,1-dimethylsilinan-4-yl)-4-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
| SMILES | C[Si]1(C)CCC(NC(=O)c2cc3c(C(F)(F)F)ccnc3[nH]2)CC1 |
| InChI | InChI=1S/C16H20F3N3OSi/c1-24(2)7-4-10(5-8-24)21-15(23)13-9-11-12(16(17,18)19)3-6-20-14(11)22-13/h3,6,9-10H,4-5,7-8H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | NKDNUOQQCXHRCI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|