C15H19Cl2N3OSi — CID 156715348
4,5-dichloro-N-(1,1-dimethylsilinan-4-yl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 156715348) has the molecular formula C15H19Cl2N3OSi and a molecular weight of 356.33 g/mol. Its IUPAC name is 4,5-dichloro-N-(1,1-dimethylsilinan-4-yl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 4,5-dichloro-N-(1,1-dimethylsilinan-4-yl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 156715348 |
| Molecular Formula | C15H19Cl2N3OSi |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 4,5-dichloro-N-(1,1-dimethylsilinan-4-yl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | C[Si]1(C)CCC(NC(=O)c2cc3c(Cl)c(Cl)ncc3[nH]2)CC1 |
| InChI | InChI=1S/C15H19Cl2N3OSi/c1-22(2)5-3-9(4-6-22)19-15(21)11-7-10-12(20-11)8-18-14(17)13(10)16/h7-9,20H,3-6H2,1-2H3,(H,19,21) |
| InChIKey | KUKWRRRNYXPTRX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|