C18H22F2N2OSi — CID 163201818
4,6-difluoro-N-(5-silaspiro[4.5]decan-8-yl)-1H-indole-2-carboxamide (PubChem CID 163201818) has the molecular formula C18H22F2N2OSi and a molecular weight of 348.47 g/mol. Its IUPAC name is 4,6-difluoro-N-(5-silaspiro[4.5]decan-8-yl)-1H-indole-2-carboxamide.
| Compound Name | 4,6-difluoro-N-(5-silaspiro[4.5]decan-8-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 163201818 |
| Molecular Formula | C18H22F2N2OSi |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 4,6-difluoro-N-(5-silaspiro[4.5]decan-8-yl)-1H-indole-2-carboxamide |
| SMILES | O=C(NC1CC[Si]2(CCCC2)CC1)c1cc2c(F)cc(F)cc2[nH]1 |
| InChI | InChI=1S/C18H22F2N2OSi/c19-12-9-15(20)14-11-17(22-16(14)10-12)18(23)21-13-3-7-24(8-4-13)5-1-2-6-24/h9-11,13,22H,1-8H2,(H,21,23) |
| InChIKey | LZUQJWBQLCGDEJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|