About CID 175268854
CID 175268854 (PubChem CID 175268854) has the molecular formula C21H25N3O2SSi2
and a molecular weight of 439.69 g/mol.
Molecular Properties
| Compound Name | CID 175268854 |
| PubChem CID | 175268854 |
| Molecular Formula | C21H25N3O2SSi2 |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | — |
| SMILES | COc1ccccc1-c1nc2[nH]c(C(=O)NC3CCC([Si]C)([Si]C)CC3)cc2s1 |
| InChI | InChI=1S/C21H25N3O2SSi2/c1-26-16-7-5-4-6-14(16)20-24-18-17(27-20)12-15(23-18)19(25)22-13-8-10-21(28-2,29-3)11-9-13/h4-7,12-13,23H,8-11H2,1-3H3,(H,22,25) |
| InChIKey | LVVAVEGUFCADBM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175268854 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175268854?
The IUPAC name of CID 175268854 (CID 175268854) is not available.
What is the SMILES notation for CID 175268854?
The canonical SMILES for CID 175268854 is COc1ccccc1-c1nc2[nH]c(C(=O)NC3CCC([Si]C)([Si]C)CC3)cc2s1.
What is the InChIKey of CID 175268854?
The InChIKey is LVVAVEGUFCADBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O2SSi2/c1-26-16-7-5-4-6-14(16)20-24-18-17(27-20)12-15(23-18)19(25)22-13-8-10-21(28-2,29-3)11-9-13/h4-7,12-13,23H,8-11H2,1-3H3,(H,22,25).
What are the key properties of CID 175268854?
CID 175268854 has a molecular weight of 439.69 g/mol, XLogP of 4.59, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175268854 is sourced from PubChem (CID 175268854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).