C21H25N3O2SSi2 — CID 175268854
CID 175268854 (PubChem CID 175268854) has the molecular formula C21H25N3O2SSi2 and a molecular weight of 439.69 g/mol.
| Compound Name | CID 175268854 |
|---|---|
| PubChem CID | 175268854 |
| Molecular Formula | C21H25N3O2SSi2 |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | — |
| SMILES | COc1ccccc1-c1nc2[nH]c(C(=O)NC3CCC([Si]C)([Si]C)CC3)cc2s1 |
| InChI | InChI=1S/C21H25N3O2SSi2/c1-26-16-7-5-4-6-14(16)20-24-18-17(27-20)12-15(23-18)19(25)22-13-8-10-21(28-2,29-3)11-9-13/h4-7,12-13,23H,8-11H2,1-3H3,(H,22,25) |
| InChIKey | LVVAVEGUFCADBM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|