C14H22N4O2SSi — CID 175268754
N-[(6S)-2,2-dimethylazasilepan-6-yl]-2-methoxy-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 175268754) has the molecular formula C14H22N4O2SSi and a molecular weight of 338.51 g/mol. Its IUPAC name is N-[(6S)-2,2-dimethylazasilepan-6-yl]-2-methoxy-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | N-[(6S)-2,2-dimethylazasilepan-6-yl]-2-methoxy-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 175268754 |
| Molecular Formula | C14H22N4O2SSi |
| Molecular Weight | 338.51 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-[(6S)-2,2-dimethylazasilepan-6-yl]-2-methoxy-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | COc1nc2[nH]c(C(=O)N[C@H]3CCC[Si](C)(C)NC3)cc2s1 |
| InChI | InChI=1S/C14H22N4O2SSi/c1-20-14-18-12-11(21-14)7-10(17-12)13(19)16-9-5-4-6-22(2,3)15-8-9/h7,9,15,17H,4-6,8H2,1-3H3,(H,16,19)/t9-/m0/s1 |
| InChIKey | GPMKHMRIJAOMTL-VIFPVBQESA-N |
| XLogP | 2.32 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|