C18H28N4O2SSi — CID 175268771
2-cyclopentyloxy-N-(3,3-dimethyl-1,3-azasilepan-7-yl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 175268771) has the molecular formula C18H28N4O2SSi and a molecular weight of 392.60 g/mol. Its IUPAC name is 2-cyclopentyloxy-N-(3,3-dimethyl-1,3-azasilepan-7-yl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | 2-cyclopentyloxy-N-(3,3-dimethyl-1,3-azasilepan-7-yl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 175268771 |
| Molecular Formula | C18H28N4O2SSi |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-cyclopentyloxy-N-(3,3-dimethyl-1,3-azasilepan-7-yl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | C[Si]1(C)CCCC(NC(=O)c2cc3sc(OC4CCCC4)nc3[nH]2)NC1 |
| InChI | InChI=1S/C18H28N4O2SSi/c1-26(2)9-5-8-15(19-11-26)21-17(23)13-10-14-16(20-13)22-18(25-14)24-12-6-3-4-7-12/h10,12,15,19-20H,3-9,11H2,1-2H3,(H,21,23) |
| InChIKey | OWESMFDWYDFDCY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|