C16H23ClN4OSi — CID 175284206
4-chloro-N-(3,3-dimethyl-1,3-azasilepan-7-yl)-6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide (PubChem CID 175284206) has the molecular formula C16H23ClN4OSi and a molecular weight of 350.93 g/mol. Its IUPAC name is 4-chloro-N-(3,3-dimethyl-1,3-azasilepan-7-yl)-6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-(3,3-dimethyl-1,3-azasilepan-7-yl)-6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175284206 |
| Molecular Formula | C16H23ClN4OSi |
| Molecular Weight | 350.93 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 4-chloro-N-(3,3-dimethyl-1,3-azasilepan-7-yl)-6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1cc(Cl)c2cc(C(=O)NC3CCC[Si](C)(C)CN3)[nH]c2n1 |
| InChI | InChI=1S/C16H23ClN4OSi/c1-10-7-12(17)11-8-13(20-15(11)19-10)16(22)21-14-5-4-6-23(2,3)9-18-14/h7-8,14,18H,4-6,9H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | HQXZCYGKQRVOET-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.93 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|