C16H21ClN3OSi — CID 175283036
CID 175283036 (PubChem CID 175283036) has the molecular formula C16H21ClN3OSi and a molecular weight of 334.90 g/mol.
| Compound Name | CID 175283036 |
|---|---|
| PubChem CID | 175283036 |
| Molecular Formula | C16H21ClN3OSi |
| Molecular Weight | 334.90 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | — |
| SMILES | Cc1cc(Cl)c2cc(C(=O)NC3CCC([Si](C)C)C3)[nH]c2n1 |
| InChI | InChI=1S/C16H21ClN3OSi/c1-9-6-13(17)12-8-14(20-15(12)18-9)16(21)19-10-4-5-11(7-10)22(2)3/h6,8,10-11H,4-5,7H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | DOQFFCZJCGOCHL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.90 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|