C22H28F3N3O — CID 175283774
N-[(3S)-2,2,6,6,7,7-hexamethyl-3-bicyclo[3.1.1]heptanyl]-4-(trifluoromethyl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 175283774) has the molecular formula C22H28F3N3O and a molecular weight of 407.48 g/mol. Its IUPAC name is N-[(3S)-2,2,6,6,7,7-hexamethyl-3-bicyclo[3.1.1]heptanyl]-4-(trifluoromethyl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[(3S)-2,2,6,6,7,7-hexamethyl-3-bicyclo[3.1.1]heptanyl]-4-(trifluoromethyl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175283774 |
| Molecular Formula | C22H28F3N3O |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-[(3S)-2,2,6,6,7,7-hexamethyl-3-bicyclo[3.1.1]heptanyl]-4-(trifluoromethyl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | CC1(C)C2C[C@H](NC(=O)c3cc4c(C(F)(F)F)cncc4[nH]3)C(C)(C)C1C2(C)C |
| InChI | InChI=1S/C22H28F3N3O/c1-19(2)15-8-16(21(5,6)18(19)20(15,3)4)28-17(29)13-7-11-12(22(23,24)25)9-26-10-14(11)27-13/h7,9-10,15-16,18,27H,8H2,1-6H3,(H,28,29)/t15?,16-,18?/m0/s1 |
| InChIKey | IVYVHKAPNONMJF-PQUAAJSLSA-N |
| XLogP | 5.41 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |