C19H25N3O2 — CID 175282985
5-methoxy-N-[(2S,3S,4S)-3,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 175282985) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 5-methoxy-N-[(2S,3S,4S)-3,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 5-methoxy-N-[(2S,3S,4S)-3,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175282985 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 5-methoxy-N-[(2S,3S,4S)-3,5,5-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | COc1cc2cc(C(=O)N[C@H]3C4C[C@@H]([C@@H]3C)C(C)(C)C4)[nH]c2cn1 |
| InChI | InChI=1S/C19H25N3O2/c1-10-13-5-12(8-19(13,2)3)17(10)22-18(23)14-6-11-7-16(24-4)20-9-15(11)21-14/h6-7,9-10,12-13,17,21H,5,8H2,1-4H3,(H,22,23)/t10-,12?,13-,17+/m0/s1 |
| InChIKey | PPUXKZZQJLGYNL-BZPNRBOKSA-N |
| XLogP | 3.37 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |