C21H16F3N3O — CID 122655009
2-pyridin-2-yl-1-[(2,3,4-trifluorophenyl)methyl]-2,3-dihydroindole-4-carboxamide (PubChem CID 122655009) has the molecular formula C21H16F3N3O and a molecular weight of 383.37 g/mol. Its IUPAC name is 2-pyridin-2-yl-1-[(2,3,4-trifluorophenyl)methyl]-2,3-dihydroindole-4-carboxamide.
| Compound Name | 2-pyridin-2-yl-1-[(2,3,4-trifluorophenyl)methyl]-2,3-dihydroindole-4-carboxamide |
|---|---|
| PubChem CID | 122655009 |
| Molecular Formula | C21H16F3N3O |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-pyridin-2-yl-1-[(2,3,4-trifluorophenyl)methyl]-2,3-dihydroindole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1CC(c1ccccn1)N2Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H16F3N3O/c22-15-8-7-12(19(23)20(15)24)11-27-17-6-3-4-13(21(25)28)14(17)10-18(27)16-5-1-2-9-26-16/h1-9,18H,10-11H2,(H2,25,28) |
| InChIKey | KGOIXKYBLSJWFY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|