C22H19F2N3O — CID 122655121
N-[4-[(3,5-difluorophenyl)methyl]-2-pyridinyl]-N-methyl-2,3-dihydro-1H-indole-4-carboxamide (PubChem CID 122655121) has the molecular formula C22H19F2N3O and a molecular weight of 379.41 g/mol. Its IUPAC name is N-[4-[(3,5-difluorophenyl)methyl]-2-pyridinyl]-N-methyl-2,3-dihydro-1H-indole-4-carboxamide.
| Compound Name | N-[4-[(3,5-difluorophenyl)methyl]-2-pyridinyl]-N-methyl-2,3-dihydro-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 122655121 |
| Molecular Formula | C22H19F2N3O |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[4-[(3,5-difluorophenyl)methyl]-2-pyridinyl]-N-methyl-2,3-dihydro-1H-indole-4-carboxamide |
| SMILES | CN(C(=O)c1cccc2c1CCN2)c1cc(Cc2cc(F)cc(F)c2)ccn1 |
| InChI | InChI=1S/C22H19F2N3O/c1-27(22(28)19-3-2-4-20-18(19)6-8-25-20)21-12-14(5-7-26-21)9-15-10-16(23)13-17(24)11-15/h2-5,7,10-13,25H,6,8-9H2,1H3 |
| InChIKey | AMAZZUOHEWGBIG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|