C25H24F3N3O3 — CID 122655049
N-(2-hydroxy-3-methoxypropyl)-N-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydro-1H-indole-4-carboxamide (PubChem CID 122655049) has the molecular formula C25H24F3N3O3 and a molecular weight of 471.48 g/mol. Its IUPAC name is N-(2-hydroxy-3-methoxypropyl)-N-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydro-1H-indole-4-carboxamide.
| Compound Name | N-(2-hydroxy-3-methoxypropyl)-N-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydro-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 122655049 |
| Molecular Formula | C25H24F3N3O3 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-(2-hydroxy-3-methoxypropyl)-N-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydro-1H-indole-4-carboxamide |
| SMILES | COCC(O)CN(C(=O)c1cccc2c1CCN2)c1cc(Cc2cc(F)c(F)c(F)c2)ccn1 |
| InChI | InChI=1S/C25H24F3N3O3/c1-34-14-17(32)13-31(25(33)19-3-2-4-22-18(19)6-8-29-22)23-12-15(5-7-30-23)9-16-10-20(26)24(28)21(27)11-16/h2-5,7,10-12,17,29,32H,6,8-9,13-14H2,1H3 |
| InChIKey | YSCPGFLISKGSFX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|