About 6-pentylpiperidine-3,4-diol
6-pentylpiperidine-3,4-diol (PubChem CID 122657014) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 6-pentylpiperidine-3,4-diol.
Molecular Properties
| Compound Name | 6-pentylpiperidine-3,4-diol |
| PubChem CID | 122657014 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 6-pentylpiperidine-3,4-diol |
| SMILES | CCCCCC1CC(O)C(O)CN1 |
| InChI | InChI=1S/C10H21NO2/c1-2-3-4-5-8-6-9(12)10(13)7-11-8/h8-13H,2-7H2,1H3 |
| InChIKey | ZYLKDWHTCSDYPW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-pentylpiperidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pentylpiperidine-3,4-diol?
The IUPAC name of 6-pentylpiperidine-3,4-diol (CID 122657014) is 6-pentylpiperidine-3,4-diol.
What is the SMILES notation for 6-pentylpiperidine-3,4-diol?
The canonical SMILES for 6-pentylpiperidine-3,4-diol is CCCCCC1CC(O)C(O)CN1.
What is the InChIKey of 6-pentylpiperidine-3,4-diol?
The InChIKey is ZYLKDWHTCSDYPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-2-3-4-5-8-6-9(12)10(13)7-11-8/h8-13H,2-7H2,1H3.
What are the key properties of 6-pentylpiperidine-3,4-diol?
6-pentylpiperidine-3,4-diol has a molecular weight of 187.28 g/mol, XLogP of 0.65, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pentylpiperidine-3,4-diol is sourced from PubChem (CID 122657014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).