C18H38N2O — CID 10402448
(2S,4S,5S)-5-amino-2-tridecylpiperidin-4-ol (PubChem CID 10402448) has the molecular formula C18H38N2O and a molecular weight of 298.51 g/mol. Its IUPAC name is (2S,4S,5S)-5-amino-2-tridecylpiperidin-4-ol.
| Compound Name | (2S,4S,5S)-5-amino-2-tridecylpiperidin-4-ol |
|---|---|
| PubChem CID | 10402448 |
| Molecular Formula | C18H38N2O |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.30 |
| IUPAC Name | (2S,4S,5S)-5-amino-2-tridecylpiperidin-4-ol |
| SMILES | CCCCCCCCCCCCC[C@H]1C[C@H](O)[C@@H](N)CN1 |
| InChI | InChI=1S/C18H38N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-14-18(21)17(19)15-20-16/h16-18,20-21H,2-15,19H2,1H3/t16-,17-,18-/m0/s1 |
| InChIKey | KXMHPOJZTZMJIV-BZSNNMDCSA-N |
| XLogP | 3.74 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|