C17H23N3O3 — CID 122658808
tert-butyl N-[1-[(6-ethynyl-5-methyl-2-pyridinyl)amino]-1-oxopropan-2-yl]-N-methylcarbamate (PubChem CID 122658808) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl N-[1-[(6-ethynyl-5-methyl-2-pyridinyl)amino]-1-oxopropan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[(6-ethynyl-5-methyl-2-pyridinyl)amino]-1-oxopropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 122658808 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | tert-butyl N-[1-[(6-ethynyl-5-methyl-2-pyridinyl)amino]-1-oxopropan-2-yl]-N-methylcarbamate |
| SMILES | C#Cc1nc(NC(=O)C(C)N(C)C(=O)OC(C)(C)C)ccc1C |
| InChI | InChI=1S/C17H23N3O3/c1-8-13-11(2)9-10-14(18-13)19-15(21)12(3)20(7)16(22)23-17(4,5)6/h1,9-10,12H,2-7H3,(H,18,19,21) |
| InChIKey | UDBVYSIODFZFEB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|