C33H46ClN5O3Si — CID 123195869
tert-butyl N-[1-[[5-chloro-4-(1-methylindazol-7-yl)-6-[2-tri(propan-2-yl)silylethynyl]-2-pyridinyl]amino]-1-oxopropan-2-yl]-N-methylcarbamate (PubChem CID 123195869) has the molecular formula C33H46ClN5O3Si and a molecular weight of 624.30 g/mol. Its IUPAC name is tert-butyl N-[1-[[5-chloro-4-(1-methylindazol-7-yl)-6-[2-tri(propan-2-yl)silylethynyl]-2-pyridinyl]amino]-1-oxopropan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[[5-chloro-4-(1-methylindazol-7-yl)-6-[2-tri(propan-2-yl)silylethynyl]-2-pyridinyl]amino]-1-oxopropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123195869 |
| Molecular Formula | C33H46ClN5O3Si |
| Molecular Weight | 624.30 g/mol |
| Exact Mass | 623.31 |
| IUPAC Name | tert-butyl N-[1-[[5-chloro-4-(1-methylindazol-7-yl)-6-[2-tri(propan-2-yl)silylethynyl]-2-pyridinyl]amino]-1-oxopropan-2-yl]-N-methylcarbamate |
| SMILES | CC(C(=O)Nc1cc(-c2cccc3cnn(C)c23)c(Cl)c(C#C[Si](C(C)C)(C(C)C)C(C)C)n1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H46ClN5O3Si/c1-20(2)43(21(3)4,22(5)6)17-16-27-29(34)26(25-15-13-14-24-19-35-39(12)30(24)25)18-28(36-27)37-31(40)23(7)38(11)32(41)42-33(8,9)10/h13-15,18-23H,1-12H3,(H,36,37,40) |
| InChIKey | JTIHUIGPJRWOHF-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.30 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|