C23H23F5N2O5S — CID 122660552
2-[4-[[3-(1,1-difluoroethoxy)phenyl]carbamothioylamino]cyclohexyl]oxy-5-(trifluoromethoxy)benzoic acid (PubChem CID 122660552) has the molecular formula C23H23F5N2O5S and a molecular weight of 534.50 g/mol. Its IUPAC name is 2-[4-[[3-(1,1-difluoroethoxy)phenyl]carbamothioylamino]cyclohexyl]oxy-5-(trifluoromethoxy)benzoic acid.
| Compound Name | 2-[4-[[3-(1,1-difluoroethoxy)phenyl]carbamothioylamino]cyclohexyl]oxy-5-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 122660552 |
| Molecular Formula | C23H23F5N2O5S |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 2-[4-[[3-(1,1-difluoroethoxy)phenyl]carbamothioylamino]cyclohexyl]oxy-5-(trifluoromethoxy)benzoic acid |
| SMILES | CC(F)(F)Oc1cccc(NC(=S)NC2CCC(Oc3ccc(OC(F)(F)F)cc3C(=O)O)CC2)c1 |
| InChI | InChI=1S/C23H23F5N2O5S/c1-22(24,25)34-16-4-2-3-14(11-16)30-21(36)29-13-5-7-15(8-6-13)33-19-10-9-17(35-23(26,27)28)12-18(19)20(31)32/h2-4,9-13,15H,5-8H2,1H3,(H,31,32)(H2,29,30,36) |
| InChIKey | SFOPIYWKFICRDH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|