C22H23F6N3O4S — CID 144808226
1-[3-[3-(1-hydroxyethylamino)-4-(trifluoromethoxy)phenoxy]cyclopentyl]-3-[3-(trifluoromethoxy)phenyl]thiourea (PubChem CID 144808226) has the molecular formula C22H23F6N3O4S and a molecular weight of 539.50 g/mol. Its IUPAC name is 1-[3-[3-(1-hydroxyethylamino)-4-(trifluoromethoxy)phenoxy]cyclopentyl]-3-[3-(trifluoromethoxy)phenyl]thiourea.
| Compound Name | 1-[3-[3-(1-hydroxyethylamino)-4-(trifluoromethoxy)phenoxy]cyclopentyl]-3-[3-(trifluoromethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 144808226 |
| Molecular Formula | C22H23F6N3O4S |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | 1-[3-[3-(1-hydroxyethylamino)-4-(trifluoromethoxy)phenoxy]cyclopentyl]-3-[3-(trifluoromethoxy)phenyl]thiourea |
| SMILES | CC(O)Nc1cc(OC2CCC(NC(=S)Nc3cccc(OC(F)(F)F)c3)C2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C22H23F6N3O4S/c1-12(32)29-18-11-16(7-8-19(18)35-22(26,27)28)33-15-6-5-14(9-15)31-20(36)30-13-3-2-4-17(10-13)34-21(23,24)25/h2-4,7-8,10-12,14-15,29,32H,5-6,9H2,1H3,(H2,30,31,36) |
| InChIKey | MQBJJCJAIIWSEB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|