C27H38F3NO10S2 — CID 122661250
2-(trifluoromethylsulfonylsulfamoyloxy)ethyl 4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)pentanoate (PubChem CID 122661250) has the molecular formula C27H38F3NO10S2 and a molecular weight of 657.73 g/mol. Its IUPAC name is 2-(trifluoromethylsulfonylsulfamoyloxy)ethyl 4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)pentanoate.
| Compound Name | 2-(trifluoromethylsulfonylsulfamoyloxy)ethyl 4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)pentanoate |
|---|---|
| PubChem CID | 122661250 |
| Molecular Formula | C27H38F3NO10S2 |
| Molecular Weight | 657.73 g/mol |
| Exact Mass | 657.19 |
| IUPAC Name | 2-(trifluoromethylsulfonylsulfamoyloxy)ethyl 4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)pentanoate |
| SMILES | CC(CCC(=O)OCCOS(=O)(=O)NS(=O)(=O)C(F)(F)F)C1CCC2C3C(=O)CC4CC(=O)CCC4(C)C3CC(=O)C12C |
| InChI | InChI=1S/C27H38F3NO10S2/c1-15(4-7-23(35)40-10-11-41-43(38,39)31-42(36,37)27(28,29)30)18-5-6-19-24-20(14-22(34)26(18,19)3)25(2)9-8-17(32)12-16(25)13-21(24)33/h15-16,18-20,24,31H,4-14H2,1-3H3 |
| InChIKey | FOBKWJGWPMKPFF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 167.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.73 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|