C28H38F4O8S — CID 162558908
4-[(4R)-4-[(13R,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid (PubChem CID 162558908) has the molecular formula C28H38F4O8S and a molecular weight of 610.66 g/mol. Its IUPAC name is 4-[(4R)-4-[(13R,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid.
| Compound Name | 4-[(4R)-4-[(13R,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 162558908 |
| Molecular Formula | C28H38F4O8S |
| Molecular Weight | 610.66 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | 4-[(4R)-4-[(13R,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
| SMILES | C[C@H](CCC(=O)OCCC(F)(F)C(F)(F)S(=O)(=O)O)[C@H]1CCC2C3C(=O)CC4CC(=O)CCC4(C)C3CC(=O)[C@@]21C |
| InChI | InChI=1S/C28H38F4O8S/c1-15(4-7-23(36)40-11-10-27(29,30)28(31,32)41(37,38)39)18-5-6-19-24-20(14-22(35)26(18,19)3)25(2)9-8-17(33)12-16(25)13-21(24)34/h15-16,18-20,24H,4-14H2,1-3H3,(H,37,38,39)/t15-,16?,18-,19?,20?,24?,25?,26-/m1/s1 |
| InChIKey | YRXXVWZSOLMHQY-KDDJNHNASA-N |
| XLogP | 5.04 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.66 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|