C27H36F4O8S — CID 123336725
4-[4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)butanoyloxy]-1,1,2,2-tetrafluorobutane-1-sulfonic acid (PubChem CID 123336725) has the molecular formula C27H36F4O8S and a molecular weight of 596.64 g/mol. Its IUPAC name is 4-[4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)butanoyloxy]-1,1,2,2-tetrafluorobutane-1-sulfonic acid.
| Compound Name | 4-[4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)butanoyloxy]-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 123336725 |
| Molecular Formula | C27H36F4O8S |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | 4-[4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)butanoyloxy]-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
| SMILES | CC12CCC(=O)CC1CC(=O)C1C2CC(=O)C2(C)C(CCCC(=O)OCCC(F)(F)C(F)(F)S(=O)(=O)O)CCC12 |
| InChI | InChI=1S/C27H36F4O8S/c1-24-9-8-17(32)12-16(24)13-20(33)23-18-7-6-15(25(18,2)21(34)14-19(23)24)4-3-5-22(35)39-11-10-26(28,29)27(30,31)40(36,37)38/h15-16,18-19,23H,3-14H2,1-2H3,(H,36,37,38) |
| InChIKey | KKMMKSBQKQPOCL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|