C27H36F4O5 — CID 90431385
3,3,4,4-tetrafluorobutyl 4-[(8R,9S,10S,13R,14S,17S)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]butanoate (PubChem CID 90431385) has the molecular formula C27H36F4O5 and a molecular weight of 516.57 g/mol. Its IUPAC name is 3,3,4,4-tetrafluorobutyl 4-[(8R,9S,10S,13R,14S,17S)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]butanoate.
| Compound Name | 3,3,4,4-tetrafluorobutyl 4-[(8R,9S,10S,13R,14S,17S)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]butanoate |
|---|---|
| PubChem CID | 90431385 |
| Molecular Formula | C27H36F4O5 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 3,3,4,4-tetrafluorobutyl 4-[(8R,9S,10S,13R,14S,17S)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]butanoate |
| SMILES | C[C@]12C(=O)C[C@H]3[C@@H](C(=O)CC4CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2CCCC(=O)OCCC(F)(F)C(F)F |
| InChI | InChI=1S/C27H36F4O5/c1-25-9-8-17(32)12-16(25)13-20(33)23-18-7-6-15(26(18,2)21(34)14-19(23)25)4-3-5-22(35)36-11-10-27(30,31)24(28)29/h15-16,18-19,23-24H,3-14H2,1-2H3/t15-,16?,18-,19-,23-,25-,26+/m0/s1 |
| InChIKey | OVJZBPVSYROIAM-WEAKSGPCSA-N |
| XLogP | 5.58 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|