C26H36F2O8S — CID 76654050
2-[4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)pentanoyloxy]-1,1-difluoroethanesulfonic acid (PubChem CID 76654050) has the molecular formula C26H36F2O8S and a molecular weight of 546.63 g/mol. Its IUPAC name is 2-[4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)pentanoyloxy]-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)pentanoyloxy]-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 76654050 |
| Molecular Formula | C26H36F2O8S |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 2-[4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)pentanoyloxy]-1,1-difluoroethanesulfonic acid |
| SMILES | CC(CCC(=O)OCC(F)(F)S(=O)(=O)O)C1CCC2C3C(=O)CC4CC(=O)CCC4(C)C3CC(=O)C12C |
| InChI | InChI=1S/C26H36F2O8S/c1-14(4-7-22(32)36-13-26(27,28)37(33,34)35)17-5-6-18-23-19(12-21(31)25(17,18)3)24(2)9-8-16(29)10-15(24)11-20(23)30/h14-15,17-19,23H,4-13H2,1-3H3,(H,33,34,35) |
| InChIKey | PXVVFAMGCAEFSQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|