C26H38F2O7S — CID 146262905
2-[(4R)-4-[(5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,12-dioxo-2,4,5,6,7,8,9,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 146262905) has the molecular formula C26H38F2O7S and a molecular weight of 532.65 g/mol. Its IUPAC name is 2-[(4R)-4-[(5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,12-dioxo-2,4,5,6,7,8,9,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[(4R)-4-[(5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,12-dioxo-2,4,5,6,7,8,9,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 146262905 |
| Molecular Formula | C26H38F2O7S |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 2-[(4R)-4-[(5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,12-dioxo-2,4,5,6,7,8,9,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | C[C@H](CCC(=O)OCC(F)(F)S(=O)(=O)O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CC(=O)CC[C@]4(C)[C@H]3CC(=O)[C@]12C |
| InChI | InChI=1S/C26H38F2O7S/c1-15(4-9-23(31)35-14-26(27,28)36(32,33)34)19-7-8-20-18-6-5-16-12-17(29)10-11-24(16,2)21(18)13-22(30)25(19,20)3/h15-16,18-21H,4-14H2,1-3H3,(H,32,33,34)/t15-,16-,18+,19-,20+,21+,24+,25-/m1/s1 |
| InChIKey | DEIZJEOZKWUKEJ-KTVNVDRLSA-N |
| XLogP | 4.83 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|