C25H34F2O8S — CID 88920851
1,1-difluoro-2-[4-[(5S,8R,9R,10S,13R,14S,17R)-13-methyl-3,7,12-trioxo-2,4,5,6,8,9,10,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyloxy]ethanesulfonic acid (PubChem CID 88920851) has the molecular formula C25H34F2O8S and a molecular weight of 532.60 g/mol. Its IUPAC name is 1,1-difluoro-2-[4-[(5S,8R,9R,10S,13R,14S,17R)-13-methyl-3,7,12-trioxo-2,4,5,6,8,9,10,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyloxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[4-[(5S,8R,9R,10S,13R,14S,17R)-13-methyl-3,7,12-trioxo-2,4,5,6,8,9,10,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyloxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 88920851 |
| Molecular Formula | C25H34F2O8S |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 1,1-difluoro-2-[4-[(5S,8R,9R,10S,13R,14S,17R)-13-methyl-3,7,12-trioxo-2,4,5,6,8,9,10,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyloxy]ethanesulfonic acid |
| SMILES | CC(CCC(=O)OCC(F)(F)S(=O)(=O)O)[C@H]1CC[C@H]2[C@@H]3C(=O)C[C@@H]4CC(=O)CC[C@@H]4[C@H]3CC(=O)[C@]12C |
| InChI | InChI=1S/C25H34F2O8S/c1-13(3-8-22(31)35-12-25(26,27)36(32,33)34)18-6-7-19-23-17(11-21(30)24(18,19)2)16-5-4-15(28)9-14(16)10-20(23)29/h13-14,16-19,23H,3-12H2,1-2H3,(H,32,33,34)/t13?,14-,16-,17+,18+,19-,23+,24+/m0/s1 |
| InChIKey | DULJNASKJMIAES-VEXPLLAYSA-N |
| XLogP | 3.62 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|