C23H19Cl2N5O5S3 — CID 122664023
[2-(sulfamoylamino)ethanimidoyl] 2-(benzenesulfonyl)-2-[6-(3,4-dichlorophenyl)-1,3-benzothiazol-2-yl]ethanimidate (PubChem CID 122664023) has the molecular formula C23H19Cl2N5O5S3 and a molecular weight of 612.54 g/mol. Its IUPAC name is [2-(sulfamoylamino)ethanimidoyl] 2-(benzenesulfonyl)-2-[6-(3,4-dichlorophenyl)-1,3-benzothiazol-2-yl]ethanimidate.
| Compound Name | [2-(sulfamoylamino)ethanimidoyl] 2-(benzenesulfonyl)-2-[6-(3,4-dichlorophenyl)-1,3-benzothiazol-2-yl]ethanimidate |
|---|---|
| PubChem CID | 122664023 |
| Molecular Formula | C23H19Cl2N5O5S3 |
| Molecular Weight | 612.54 g/mol |
| Exact Mass | 610.99 |
| IUPAC Name | [2-(sulfamoylamino)ethanimidoyl] 2-(benzenesulfonyl)-2-[6-(3,4-dichlorophenyl)-1,3-benzothiazol-2-yl]ethanimidate |
| SMILES | [H]/N=C(\O/C(CNS(N)(=O)=O)=N/[H])C(c1nc2ccc(-c3ccc(Cl)c(Cl)c3)cc2s1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19Cl2N5O5S3/c24-16-8-6-13(10-17(16)25)14-7-9-18-19(11-14)36-23(30-18)21(37(31,32)15-4-2-1-3-5-15)22(27)35-20(26)12-29-38(28,33)34/h1-11,21,26-27,29H,12H2,(H2,28,33,34)/b26-20+,27-22- |
| InChIKey | JFVSCGVVVVQTKO-NDQPBIHBSA-N |
| XLogP | 4.55 |
| TPSA | 176.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|