C24H17Cl2N4O5S3- — CID 90057736
2-[benzylsulfonyl-[6-(3,4-dichlorophenyl)-1,3-benzothiazol-2-yl]methyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole (PubChem CID 90057736) has the molecular formula C24H17Cl2N4O5S3- and a molecular weight of 608.53 g/mol. Its IUPAC name is 2-[benzylsulfonyl-[6-(3,4-dichlorophenyl)-1,3-benzothiazol-2-yl]methyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[benzylsulfonyl-[6-(3,4-dichlorophenyl)-1,3-benzothiazol-2-yl]methyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 90057736 |
| Molecular Formula | C24H17Cl2N4O5S3- |
| Molecular Weight | 608.53 g/mol |
| Exact Mass | 606.97 |
| IUPAC Name | 2-[benzylsulfonyl-[6-(3,4-dichlorophenyl)-1,3-benzothiazol-2-yl]methyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole |
| SMILES | O=S([O-])NCc1nnc(C(c2nc3ccc(-c4ccc(Cl)c(Cl)c4)cc3s2)S(=O)(=O)Cc2ccccc2)o1 |
| InChI | InChI=1S/C24H18Cl2N4O5S3/c25-17-8-6-15(10-18(17)26)16-7-9-19-20(11-16)36-24(28-19)22(23-30-29-21(35-23)12-27-37(31)32)38(33,34)13-14-4-2-1-3-5-14/h1-11,22,27H,12-13H2,(H,31,32)/p-1 |
| InChIKey | BLHFWZAWHUFCLP-UHFFFAOYSA-M |
| XLogP | 5.24 |
| TPSA | 138.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|