C22H21N6O6S3- — CID 90056746
2-[[6-[3-(azetidine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-methylsulfonylmethyl]-5-[(2-sulfinatohydrazinyl)methyl]-1,3,4-oxadiazole (PubChem CID 90056746) has the molecular formula C22H21N6O6S3- and a molecular weight of 561.65 g/mol. Its IUPAC name is 2-[[6-[3-(azetidine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-methylsulfonylmethyl]-5-[(2-sulfinatohydrazinyl)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[[6-[3-(azetidine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-methylsulfonylmethyl]-5-[(2-sulfinatohydrazinyl)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 90056746 |
| Molecular Formula | C22H21N6O6S3- |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | 2-[[6-[3-(azetidine-1-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-methylsulfonylmethyl]-5-[(2-sulfinatohydrazinyl)methyl]-1,3,4-oxadiazole |
| SMILES | CS(=O)(=O)C(c1nnc(CNNS(=O)[O-])o1)c1nc2ccc(-c3cccc(C(=O)N4CCC4)c3)cc2s1 |
| InChI | InChI=1S/C22H22N6O6S3/c1-37(32,33)19(20-26-25-18(34-20)12-23-27-36(30)31)21-24-16-7-6-14(11-17(16)35-21)13-4-2-5-15(10-13)22(29)28-8-3-9-28/h2,4-7,10-11,19,23,27H,3,8-9,12H2,1H3,(H,30,31)/p-1 |
| InChIKey | JPOQFFGQFPLKTP-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 170.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|