C24H18ClN4O5S3- — CID 90056699
2-[benzylsulfonyl-[6-(4-chlorophenyl)-1,3-benzothiazol-2-yl]methyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole (PubChem CID 90056699) has the molecular formula C24H18ClN4O5S3- and a molecular weight of 574.09 g/mol. Its IUPAC name is 2-[benzylsulfonyl-[6-(4-chlorophenyl)-1,3-benzothiazol-2-yl]methyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[benzylsulfonyl-[6-(4-chlorophenyl)-1,3-benzothiazol-2-yl]methyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 90056699 |
| Molecular Formula | C24H18ClN4O5S3- |
| Molecular Weight | 574.09 g/mol |
| Exact Mass | 573.01 |
| IUPAC Name | 2-[benzylsulfonyl-[6-(4-chlorophenyl)-1,3-benzothiazol-2-yl]methyl]-5-[(sulfinatoamino)methyl]-1,3,4-oxadiazole |
| SMILES | O=S([O-])NCc1nnc(C(c2nc3ccc(-c4ccc(Cl)cc4)cc3s2)S(=O)(=O)Cc2ccccc2)o1 |
| InChI | InChI=1S/C24H19ClN4O5S3/c25-18-9-6-16(7-10-18)17-8-11-19-20(12-17)35-24(27-19)22(23-29-28-21(34-23)13-26-36(30)31)37(32,33)14-15-4-2-1-3-5-15/h1-12,22,26H,13-14H2,(H,30,31)/p-1 |
| InChIKey | YKXPYZRCRDSTFM-UHFFFAOYSA-M |
| XLogP | 4.59 |
| TPSA | 138.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.09 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|